C21H24O3 — CID 71725331
(1S,2S,4R,5R)-2,4-bis(phenylmethoxy)-8-oxabicyclo[3.2.1]octane (PubChem CID 71725331) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is (1S,2S,4R,5R)-2,4-bis(phenylmethoxy)-8-oxabicyclo[3.2.1]octane.
| Compound Name | (1S,2S,4R,5R)-2,4-bis(phenylmethoxy)-8-oxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 71725331 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | (1S,2S,4R,5R)-2,4-bis(phenylmethoxy)-8-oxabicyclo[3.2.1]octane |
| SMILES | c1ccc(CO[C@H]2C[C@@H](OCc3ccccc3)[C@H]3CC[C@@H]2O3)cc1 |
| InChI | InChI=1S/C21H24O3/c1-3-7-16(8-4-1)14-22-20-13-21(19-12-11-18(20)24-19)23-15-17-9-5-2-6-10-17/h1-10,18-21H,11-15H2/t18-,19+,20-,21+ |
| InChIKey | LMOHAKRGDWOFFD-FXELSEDVSA-N |
| XLogP | 4.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |