About azane;[(1R)-2-methylcyclopropyl]oxymethylbenzene
azane;[(1R)-2-methylcyclopropyl]oxymethylbenzene (PubChem CID 66809677) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is azane;[(1R)-2-methylcyclopropyl]oxymethylbenzene.
Molecular Properties
| Compound Name | azane;[(1R)-2-methylcyclopropyl]oxymethylbenzene |
| PubChem CID | 66809677 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | azane;[(1R)-2-methylcyclopropyl]oxymethylbenzene |
| SMILES | CC1C[C@H]1OCc1ccccc1.N |
| InChI | InChI=1S/C11H14O.H3N/c1-9-7-11(9)12-8-10-5-3-2-4-6-10;/h2-6,9,11H,7-8H2,1H3;1H3/t9?,11-;/m1./s1 |
| InChIKey | IDQRFBOEELKSNP-HHDUEHQLSA-N |
| XLogP | 2.77 |
| TPSA | 44.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;[(1R)-2-methylcyclopropyl]oxymethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;[(1R)-2-methylcyclopropyl]oxymethylbenzene?
The IUPAC name of azane;[(1R)-2-methylcyclopropyl]oxymethylbenzene (CID 66809677) is azane;[(1R)-2-methylcyclopropyl]oxymethylbenzene.
What is the SMILES notation for azane;[(1R)-2-methylcyclopropyl]oxymethylbenzene?
The canonical SMILES for azane;[(1R)-2-methylcyclopropyl]oxymethylbenzene is CC1C[C@H]1OCc1ccccc1.N.
What is the InChIKey of azane;[(1R)-2-methylcyclopropyl]oxymethylbenzene?
The InChIKey is IDQRFBOEELKSNP-HHDUEHQLSA-N. The full InChI is InChI=1S/C11H14O.H3N/c1-9-7-11(9)12-8-10-5-3-2-4-6-10;/h2-6,9,11H,7-8H2,1H3;1H3/t9?,11-;/m1./s1.
What are the key properties of azane;[(1R)-2-methylcyclopropyl]oxymethylbenzene?
azane;[(1R)-2-methylcyclopropyl]oxymethylbenzene has a molecular weight of 179.26 g/mol, XLogP of 2.77, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;[(1R)-2-methylcyclopropyl]oxymethylbenzene is sourced from PubChem (CID 66809677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).