C21H26O3 — CID 59979356
(1R,2R,3R,5S)-5-methyl-2,3-bis(phenylmethoxy)cyclohexan-1-ol (PubChem CID 59979356) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (1R,2R,3R,5S)-5-methyl-2,3-bis(phenylmethoxy)cyclohexan-1-ol.
| Compound Name | (1R,2R,3R,5S)-5-methyl-2,3-bis(phenylmethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 59979356 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (1R,2R,3R,5S)-5-methyl-2,3-bis(phenylmethoxy)cyclohexan-1-ol |
| SMILES | C[C@H]1C[C@@H](O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1 |
| InChI | InChI=1S/C21H26O3/c1-16-12-19(22)21(24-15-18-10-6-3-7-11-18)20(13-16)23-14-17-8-4-2-5-9-17/h2-11,16,19-22H,12-15H2,1H3/t16-,19+,20+,21+/m0/s1 |
| InChIKey | IJLVHTBTBOPNNB-LLUDDFSJSA-N |
| XLogP | 3.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |