C28H32O4 — CID 70901451
(1S,3R,4S)-5-methyl-2,3,4-tris(phenylmethoxy)cyclohexan-1-ol (PubChem CID 70901451) has the molecular formula C28H32O4 and a molecular weight of 432.56 g/mol. Its IUPAC name is (1S,3R,4S)-5-methyl-2,3,4-tris(phenylmethoxy)cyclohexan-1-ol.
| Compound Name | (1S,3R,4S)-5-methyl-2,3,4-tris(phenylmethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 70901451 |
| Molecular Formula | C28H32O4 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | (1S,3R,4S)-5-methyl-2,3,4-tris(phenylmethoxy)cyclohexan-1-ol |
| SMILES | CC1CC(O)C(OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H32O4/c1-21-17-25(29)27(31-19-23-13-7-3-8-14-23)28(32-20-24-15-9-4-10-16-24)26(21)30-18-22-11-5-2-6-12-22/h2-16,21,25-29H,17-20H2,1H3/t21?,25?,26-,27?,28+/m0/s1 |
| InChIKey | IPQLFHBMETVZNY-ASSHEDPHSA-N |
| XLogP | 5.14 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |