C27H31NO4 — CID 15460032
(1S,2S,3S,4R,5R)-5-amino-2,3,4-tris(phenylmethoxy)cyclohexan-1-ol (PubChem CID 15460032) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is (1S,2S,3S,4R,5R)-5-amino-2,3,4-tris(phenylmethoxy)cyclohexan-1-ol.
| Compound Name | (1S,2S,3S,4R,5R)-5-amino-2,3,4-tris(phenylmethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 15460032 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | (1S,2S,3S,4R,5R)-5-amino-2,3,4-tris(phenylmethoxy)cyclohexan-1-ol |
| SMILES | NC1C[C@H](O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H31NO4/c28-23-16-24(29)26(31-18-21-12-6-2-7-13-21)27(32-19-22-14-8-3-9-15-22)25(23)30-17-20-10-4-1-5-11-20/h1-15,23-27,29H,16-19,28H2/t23?,24-,25+,26-,27-/m0/s1 |
| InChIKey | WNTJQJDTOCYUBQ-VTLMFNHFSA-N |
| XLogP | 3.83 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |