C13H17ClO4 — CID 100947422
(1S,2R,4S,5S,6R)-6-chloro-5-phenylmethoxycyclohexane-1,2,4-triol (PubChem CID 100947422) has the molecular formula C13H17ClO4 and a molecular weight of 272.73 g/mol. Its IUPAC name is (1S,2R,4S,5S,6R)-6-chloro-5-phenylmethoxycyclohexane-1,2,4-triol.
| Compound Name | (1S,2R,4S,5S,6R)-6-chloro-5-phenylmethoxycyclohexane-1,2,4-triol |
|---|---|
| PubChem CID | 100947422 |
| Molecular Formula | C13H17ClO4 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (1S,2R,4S,5S,6R)-6-chloro-5-phenylmethoxycyclohexane-1,2,4-triol |
| SMILES | O[C@@H]1[C@@H](Cl)[C@@H](OCc2ccccc2)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C13H17ClO4/c14-11-12(17)9(15)6-10(16)13(11)18-7-8-4-2-1-3-5-8/h1-5,9-13,15-17H,6-7H2/t9-,10+,11-,12+,13+/m1/s1 |
| InChIKey | LWTPZTBOPJHOSZ-FHUSYTEZSA-N |
| XLogP | 0.67 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|