C27H30O6 — CID 101254496
(1S,2R,3R,4S,5R,6R)-3,5,6-tris(phenylmethoxy)cyclohexane-1,2,4-triol (PubChem CID 101254496) has the molecular formula C27H30O6 and a molecular weight of 450.53 g/mol. Its IUPAC name is (1S,2R,3R,4S,5R,6R)-3,5,6-tris(phenylmethoxy)cyclohexane-1,2,4-triol.
| Compound Name | (1S,2R,3R,4S,5R,6R)-3,5,6-tris(phenylmethoxy)cyclohexane-1,2,4-triol |
|---|---|
| PubChem CID | 101254496 |
| Molecular Formula | C27H30O6 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | (1S,2R,3R,4S,5R,6R)-3,5,6-tris(phenylmethoxy)cyclohexane-1,2,4-triol |
| SMILES | OC1[C@@H](O)[C@@H](OCc2ccccc2)[C@H](O)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H30O6/c28-22-23(29)26(32-17-20-12-6-2-7-13-20)27(33-18-21-14-8-3-9-15-21)24(30)25(22)31-16-19-10-4-1-5-11-19/h1-15,22-30H,16-18H2/t22-,23?,24+,25-,26-,27-/m1/s1 |
| InChIKey | IXMGEOOZRLCUTD-SLEJRYBGSA-N |
| XLogP | 2.84 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |