C22H26O7 — CID 101210421
[(1S,2S,3R,4S,5R,6S)-2,3,5-trihydroxy-4,6-bis(phenylmethoxy)cyclohexyl] acetate (PubChem CID 101210421) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is [(1S,2S,3R,4S,5R,6S)-2,3,5-trihydroxy-4,6-bis(phenylmethoxy)cyclohexyl] acetate.
| Compound Name | [(1S,2S,3R,4S,5R,6S)-2,3,5-trihydroxy-4,6-bis(phenylmethoxy)cyclohexyl] acetate |
|---|---|
| PubChem CID | 101210421 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [(1S,2S,3R,4S,5R,6S)-2,3,5-trihydroxy-4,6-bis(phenylmethoxy)cyclohexyl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](O)[C@@H](O)[C@H](OCc2ccccc2)[C@@H](O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H26O7/c1-14(23)29-22-18(25)17(24)20(27-12-15-8-4-2-5-9-15)19(26)21(22)28-13-16-10-6-3-7-11-16/h2-11,17-22,24-26H,12-13H2,1H3/t17-,18+,19-,20+,21+,22+/m1/s1 |
| InChIKey | CHRKMGLBJWVTME-CIQOUTPZSA-N |
| XLogP | 1.19 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |