C34H34O7 — CID 101210423
[(1S,2S,3R,4S,5R,6S)-2,3,5-trihydroxy-4,6-bis(phenylmethoxy)cyclohexyl] 2,2-diphenylacetate (PubChem CID 101210423) has the molecular formula C34H34O7 and a molecular weight of 554.64 g/mol. Its IUPAC name is [(1S,2S,3R,4S,5R,6S)-2,3,5-trihydroxy-4,6-bis(phenylmethoxy)cyclohexyl] 2,2-diphenylacetate.
| Compound Name | [(1S,2S,3R,4S,5R,6S)-2,3,5-trihydroxy-4,6-bis(phenylmethoxy)cyclohexyl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 101210423 |
| Molecular Formula | C34H34O7 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | [(1S,2S,3R,4S,5R,6S)-2,3,5-trihydroxy-4,6-bis(phenylmethoxy)cyclohexyl] 2,2-diphenylacetate |
| SMILES | O=C(O[C@H]1[C@@H](O)[C@@H](O)[C@H](OCc2ccccc2)C(O)[C@@H]1OCc1ccccc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H34O7/c35-28-29(36)33(41-34(38)27(25-17-9-3-10-18-25)26-19-11-4-12-20-26)32(40-22-24-15-7-2-8-16-24)30(37)31(28)39-21-23-13-5-1-6-14-23/h1-20,27-33,35-37H,21-22H2/t28-,29+,30?,31+,32+,33+/m1/s1 |
| InChIKey | ICBJWTITNJNKMO-GLWDFVHWSA-N |
| XLogP | 4.00 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |