C33H32O7 — CID 101358027
[(1S,2S,3R,4S,5R,6S)-2,3,5-trihydroxy-4,6-bis(phenylmethoxy)cyclohexyl] 4-phenylbenzoate (PubChem CID 101358027) has the molecular formula C33H32O7 and a molecular weight of 540.61 g/mol. Its IUPAC name is [(1S,2S,3R,4S,5R,6S)-2,3,5-trihydroxy-4,6-bis(phenylmethoxy)cyclohexyl] 4-phenylbenzoate.
| Compound Name | [(1S,2S,3R,4S,5R,6S)-2,3,5-trihydroxy-4,6-bis(phenylmethoxy)cyclohexyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 101358027 |
| Molecular Formula | C33H32O7 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | [(1S,2S,3R,4S,5R,6S)-2,3,5-trihydroxy-4,6-bis(phenylmethoxy)cyclohexyl] 4-phenylbenzoate |
| SMILES | O=C(O[C@H]1[C@@H](O)[C@@H](O)[C@H](OCc2ccccc2)C(O)[C@@H]1OCc1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H32O7/c34-27-28(35)32(40-33(37)26-18-16-25(17-19-26)24-14-8-3-9-15-24)31(39-21-23-12-6-2-7-13-23)29(36)30(27)38-20-22-10-4-1-5-11-22/h1-19,27-32,34-36H,20-21H2/t27-,28+,29?,30+,31+,32+/m1/s1 |
| InChIKey | HVNKOWILVJEPDG-FCYDQIBESA-N |
| XLogP | 4.15 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |