C40H36O8 — CID 177482281
[(1S,2S,3R,4R,6S)-3-benzoyloxy-2,5-dihydroxy-4,6-bis(phenylmethoxy)cyclohexyl] 4-phenylbenzoate (PubChem CID 177482281) has the molecular formula C40H36O8 and a molecular weight of 644.72 g/mol. Its IUPAC name is [(1S,2S,3R,4R,6S)-3-benzoyloxy-2,5-dihydroxy-4,6-bis(phenylmethoxy)cyclohexyl] 4-phenylbenzoate.
| Compound Name | [(1S,2S,3R,4R,6S)-3-benzoyloxy-2,5-dihydroxy-4,6-bis(phenylmethoxy)cyclohexyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 177482281 |
| Molecular Formula | C40H36O8 |
| Molecular Weight | 644.72 g/mol |
| Exact Mass | 644.24 |
| IUPAC Name | [(1S,2S,3R,4R,6S)-3-benzoyloxy-2,5-dihydroxy-4,6-bis(phenylmethoxy)cyclohexyl] 4-phenylbenzoate |
| SMILES | O=C(O[C@@H]1[C@H](O)[C@H](OC(=O)c2ccc(-c3ccccc3)cc2)[C@@H](OCc2ccccc2)C(O)[C@H]1OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H36O8/c41-33-35(45-25-27-13-5-1-6-14-27)37(47-39(43)31-19-11-4-12-20-31)34(42)38(36(33)46-26-28-15-7-2-8-16-28)48-40(44)32-23-21-30(22-24-32)29-17-9-3-10-18-29/h1-24,33-38,41-42H,25-26H2/t33?,34-,35+,36-,37+,38-/m0/s1 |
| InChIKey | GREZYJCGJUMZIO-LHYOZKOSSA-N |
| XLogP | 6.01 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.72 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |