C29H32O7 — CID 100921481
[(2S,3S,5R,6S)-2,6-dihydroxy-3,4,5-tris(phenylmethoxy)cyclohexyl] acetate (PubChem CID 100921481) has the molecular formula C29H32O7 and a molecular weight of 492.57 g/mol. Its IUPAC name is [(2S,3S,5R,6S)-2,6-dihydroxy-3,4,5-tris(phenylmethoxy)cyclohexyl] acetate.
| Compound Name | [(2S,3S,5R,6S)-2,6-dihydroxy-3,4,5-tris(phenylmethoxy)cyclohexyl] acetate |
|---|---|
| PubChem CID | 100921481 |
| Molecular Formula | C29H32O7 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | [(2S,3S,5R,6S)-2,6-dihydroxy-3,4,5-tris(phenylmethoxy)cyclohexyl] acetate |
| SMILES | CC(=O)OC1C(O)[C@@H](OCc2ccccc2)C(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C29H32O7/c1-20(30)36-26-24(31)27(33-17-21-11-5-2-6-12-21)29(35-19-23-15-9-4-10-16-23)28(25(26)32)34-18-22-13-7-3-8-14-22/h2-16,24-29,31-32H,17-19H2,1H3/t24-,25?,26?,27+,28-,29?/m1/s1 |
| InChIKey | ATBMEBTXNDVEBI-YHPQVMBTSA-N |
| XLogP | 3.41 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |