C22H26O6 — CID 70841959
[(2R,4S,5S)-2-hydroxy-6-methyl-4,5-bis(phenylmethoxy)oxan-3-yl] acetate (PubChem CID 70841959) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is [(2R,4S,5S)-2-hydroxy-6-methyl-4,5-bis(phenylmethoxy)oxan-3-yl] acetate.
| Compound Name | [(2R,4S,5S)-2-hydroxy-6-methyl-4,5-bis(phenylmethoxy)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 70841959 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | [(2R,4S,5S)-2-hydroxy-6-methyl-4,5-bis(phenylmethoxy)oxan-3-yl] acetate |
| SMILES | CC(=O)OC1[C@H](O)OC(C)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H26O6/c1-15-19(25-13-17-9-5-3-6-10-17)20(21(22(24)27-15)28-16(2)23)26-14-18-11-7-4-8-12-18/h3-12,15,19-22,24H,13-14H2,1-2H3/t15?,19-,20-,21?,22+/m0/s1 |
| InChIKey | BRCHFKBNPWRFCD-WZFNXHJOSA-N |
| XLogP | 2.83 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |