C36H44O9 — CID 70841927
[(4S,5S)-4-[(2S,4R,5S)-3,6-dimethyl-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-2-hydroxy-6-methyl-5-phenylmethoxyoxan-3-yl] acetate (PubChem CID 70841927) has the molecular formula C36H44O9 and a molecular weight of 620.74 g/mol. Its IUPAC name is [(4S,5S)-4-[(2S,4R,5S)-3,6-dimethyl-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-2-hydroxy-6-methyl-5-phenylmethoxyoxan-3-yl] acetate.
| Compound Name | [(4S,5S)-4-[(2S,4R,5S)-3,6-dimethyl-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-2-hydroxy-6-methyl-5-phenylmethoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 70841927 |
| Molecular Formula | C36H44O9 |
| Molecular Weight | 620.74 g/mol |
| Exact Mass | 620.30 |
| IUPAC Name | [(4S,5S)-4-[(2S,4R,5S)-3,6-dimethyl-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-2-hydroxy-6-methyl-5-phenylmethoxyoxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(O)OC(C)[C@H](OCc2ccccc2)[C@@H]1O[C@@H]1OC(C)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1C |
| InChI | InChI=1S/C36H44O9/c1-23-30(39-20-27-14-8-5-9-15-27)31(40-21-28-16-10-6-11-17-28)25(3)43-36(23)45-33-32(41-22-29-18-12-7-13-19-29)24(2)42-35(38)34(33)44-26(4)37/h5-19,23-25,30-36,38H,20-22H2,1-4H3/t23?,24?,25?,30-,31+,32+,33+,34?,35?,36+/m1/s1 |
| InChIKey | GJCWWIHMYBSQBV-HBWMCIQXSA-N |
| XLogP | 5.18 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.74 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |