C23H32O7 — CID 118517814
[(2S,3R,4S,5R,6R)-2-[[(1S,2R,4R,5R,6S)-2,4-dimethyl-3,7-dioxabicyclo[4.1.0]heptan-5-yl]oxy]-5,6-dimethyl-4-phenylmethoxyoxan-3-yl] acetate (PubChem CID 118517814) has the molecular formula C23H32O7 and a molecular weight of 420.50 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-2-[[(1S,2R,4R,5R,6S)-2,4-dimethyl-3,7-dioxabicyclo[4.1.0]heptan-5-yl]oxy]-5,6-dimethyl-4-phenylmethoxyoxan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,5R,6R)-2-[[(1S,2R,4R,5R,6S)-2,4-dimethyl-3,7-dioxabicyclo[4.1.0]heptan-5-yl]oxy]-5,6-dimethyl-4-phenylmethoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 118517814 |
| Molecular Formula | C23H32O7 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-2-[[(1S,2R,4R,5R,6S)-2,4-dimethyl-3,7-dioxabicyclo[4.1.0]heptan-5-yl]oxy]-5,6-dimethyl-4-phenylmethoxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](O[C@H]2[C@H]3O[C@H]3[C@@H](C)O[C@@H]2C)O[C@H](C)[C@@H](C)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H32O7/c1-12-13(2)27-23(30-20-15(4)26-14(3)19-21(20)29-19)22(28-16(5)24)18(12)25-11-17-9-7-6-8-10-17/h6-10,12-15,18-23H,11H2,1-5H3/t12-,13-,14-,15-,18+,19+,20-,21+,22-,23+/m1/s1 |
| InChIKey | CDGDNKDTDKOIFS-ZEBIOIPGSA-N |
| XLogP | 2.84 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|