C43H50O9S — CID 10101534
[(2S,3S,4R,5R,6S)-2-methyl-6-[(2S,3S,4R,5R,6S)-2-methyl-6-methylsulfanyl-4,5-bis(phenylmethoxy)oxan-3-yl]oxy-4,5-bis(phenylmethoxy)oxan-3-yl] acetate (PubChem CID 10101534) has the molecular formula C43H50O9S and a molecular weight of 742.93 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6S)-2-methyl-6-[(2S,3S,4R,5R,6S)-2-methyl-6-methylsulfanyl-4,5-bis(phenylmethoxy)oxan-3-yl]oxy-4,5-bis(phenylmethoxy)oxan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,5R,6S)-2-methyl-6-[(2S,3S,4R,5R,6S)-2-methyl-6-methylsulfanyl-4,5-bis(phenylmethoxy)oxan-3-yl]oxy-4,5-bis(phenylmethoxy)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 10101534 |
| Molecular Formula | C43H50O9S |
| Molecular Weight | 742.93 g/mol |
| Exact Mass | 742.32 |
| IUPAC Name | [(2S,3S,4R,5R,6S)-2-methyl-6-[(2S,3S,4R,5R,6S)-2-methyl-6-methylsulfanyl-4,5-bis(phenylmethoxy)oxan-3-yl]oxy-4,5-bis(phenylmethoxy)oxan-3-yl] acetate |
| SMILES | CS[C@@H]1O[C@@H](C)[C@H](O[C@@H]2O[C@@H](C)[C@H](OC(C)=O)[C@@H](OCc3ccccc3)[C@H]2OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C43H50O9S/c1-29-36(51-31(3)44)38(45-25-32-17-9-5-10-18-32)40(47-27-34-21-13-7-14-22-34)42(49-29)52-37-30(2)50-43(53-4)41(48-28-35-23-15-8-16-24-35)39(37)46-26-33-19-11-6-12-20-33/h5-24,29-30,36-43H,25-28H2,1-4H3/t29-,30-,36-,37-,38+,39+,40+,41+,42-,43-/m0/s1 |
| InChIKey | VESFFJSZWUGOIE-YLXDAFQOSA-N |
| XLogP | 7.50 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.93 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |