C25H28O9 — CID 11754556
[(2R,3S,4R,5R,6R)-2,6-diacetyloxy-4,5-bis(phenylmethoxy)oxan-3-yl] acetate (PubChem CID 11754556) has the molecular formula C25H28O9 and a molecular weight of 472.49 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-2,6-diacetyloxy-4,5-bis(phenylmethoxy)oxan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-2,6-diacetyloxy-4,5-bis(phenylmethoxy)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 11754556 |
| Molecular Formula | C25H28O9 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-2,6-diacetyloxy-4,5-bis(phenylmethoxy)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@H](OC(C)=O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H28O9/c1-16(26)31-23-21(29-14-19-10-6-4-7-11-19)22(30-15-20-12-8-5-9-13-20)24(32-17(2)27)34-25(23)33-18(3)28/h4-13,21-25H,14-15H2,1-3H3/t21-,22-,23+,24+,25+/m1/s1 |
| InChIKey | FERLASMGCRKFSU-VAFBSOEGSA-N |
| XLogP | 2.90 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|