C30H32O6 — CID 101254952
[(2R,3R,4S,5S,6R)-6-ethenyl-3,4,5-tris(phenylmethoxy)oxan-2-yl] acetate (PubChem CID 101254952) has the molecular formula C30H32O6 and a molecular weight of 488.58 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-6-ethenyl-3,4,5-tris(phenylmethoxy)oxan-2-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-6-ethenyl-3,4,5-tris(phenylmethoxy)oxan-2-yl] acetate |
|---|---|
| PubChem CID | 101254952 |
| Molecular Formula | C30H32O6 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-6-ethenyl-3,4,5-tris(phenylmethoxy)oxan-2-yl] acetate |
| SMILES | C=C[C@H]1O[C@H](OC(C)=O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H32O6/c1-3-26-27(32-19-23-13-7-4-8-14-23)28(33-20-24-15-9-5-10-16-24)29(30(36-26)35-22(2)31)34-21-25-17-11-6-12-18-25/h3-18,26-30H,1,19-21H2,2H3/t26-,27+,28+,29-,30+/m1/s1 |
| InChIKey | UERMETKVYXUUIS-QBHLCAJUSA-N |
| XLogP | 5.22 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|