C31H35NO7 — CID 101099088
[(2R,3R,4S,5R,6S)-6-(acetamidomethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl] acetate (PubChem CID 101099088) has the molecular formula C31H35NO7 and a molecular weight of 533.62 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-(acetamidomethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-6-(acetamidomethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl] acetate |
|---|---|
| PubChem CID | 101099088 |
| Molecular Formula | C31H35NO7 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-(acetamidomethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl] acetate |
| SMILES | CC(=O)NC[C@@H]1O[C@H](OC(C)=O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C31H35NO7/c1-22(33)32-18-27-28(35-19-24-12-6-3-7-13-24)29(36-20-25-14-8-4-9-15-25)30(31(39-27)38-23(2)34)37-21-26-16-10-5-11-17-26/h3-17,27-31H,18-21H2,1-2H3,(H,32,33)/t27-,28+,29-,30+,31-/m0/s1 |
| InChIKey | ZDYBBJWQJTWATI-LIIQBVBMSA-N |
| XLogP | 4.17 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |