C36H38O7 — CID 91699912
[(2S,3R,4S,5S,6R)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]methyl acetate (PubChem CID 91699912) has the molecular formula C36H38O7 and a molecular weight of 582.69 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4S,5S,6R)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 91699912 |
| Molecular Formula | C36H38O7 |
| Molecular Weight | 582.69 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H38O7/c1-27(37)38-26-32-33(39-22-28-14-6-2-7-15-28)34(40-23-29-16-8-3-9-17-29)35(41-24-30-18-10-4-11-19-30)36(43-32)42-25-31-20-12-5-13-21-31/h2-21,32-36H,22-26H2,1H3/t32-,33+,34-,35-,36+/m0/s1 |
| InChIKey | YEELBAWKPSBSET-WGZBAJHCSA-N |
| XLogP | 6.25 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.69 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |