C49H60O14Si — CID 59051820
[(2R,3R,4S,5S,6S)-3,4-diacetyloxy-6-[[(2R,3R,4S,5R,6R)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]methoxy]-5-trimethylsilyloxyoxan-2-yl]methyl acetate (PubChem CID 59051820) has the molecular formula C49H60O14Si and a molecular weight of 901.09 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-3,4-diacetyloxy-6-[[(2R,3R,4S,5R,6R)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]methoxy]-5-trimethylsilyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-3,4-diacetyloxy-6-[[(2R,3R,4S,5R,6R)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]methoxy]-5-trimethylsilyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 59051820 |
| Molecular Formula | C49H60O14Si |
| Molecular Weight | 901.09 g/mol |
| Exact Mass | 900.38 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3,4-diacetyloxy-6-[[(2R,3R,4S,5R,6R)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]methoxy]-5-trimethylsilyloxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC[C@H]2O[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)[C@@H](O[Si](C)(C)C)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C49H60O14Si/c1-33(50)53-31-41-43(59-34(2)51)45(60-35(3)52)47(63-64(4,5)6)49(62-41)58-32-40-42(54-27-36-19-11-7-12-20-36)44(55-28-37-21-13-8-14-22-37)46(56-29-38-23-15-9-16-24-38)48(61-40)57-30-39-25-17-10-18-26-39/h7-26,40-49H,27-32H2,1-6H3/t40-,41-,42-,43-,44+,45+,46-,47+,48-,49+/m1/s1 |
| InChIKey | QMLAAEHDCTYCAU-AXAVGBIXSA-N |
| XLogP | 7.07 |
| TPSA | 152.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.09 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|