C33H44O16S — CID 24813283
[(2R,3R,4S,5R,6S)-3,4-diacetyloxy-5-phenylmethoxy-6-[[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-ethylsulfanyloxan-2-yl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 24813283) has the molecular formula C33H44O16S and a molecular weight of 728.77 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4-diacetyloxy-5-phenylmethoxy-6-[[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-ethylsulfanyloxan-2-yl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4-diacetyloxy-5-phenylmethoxy-6-[[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-ethylsulfanyloxan-2-yl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 24813283 |
| Molecular Formula | C33H44O16S |
| Molecular Weight | 728.77 g/mol |
| Exact Mass | 728.24 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4-diacetyloxy-5-phenylmethoxy-6-[[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-ethylsulfanyloxan-2-yl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | CCS[C@@H]1O[C@H](CO[C@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OCc2ccccc2)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C33H44O16S/c1-8-50-33-31(47-22(7)39)29(46-21(6)38)27(44-19(4)36)25(49-33)16-42-32-30(41-14-23-12-10-9-11-13-23)28(45-20(5)37)26(43-18(3)35)24(48-32)15-40-17(2)34/h9-13,24-33H,8,14-16H2,1-7H3/t24-,25-,26-,27-,28+,29+,30-,31-,32+,33+/m1/s1 |
| InChIKey | VGKKETJMVJEDEV-GHVXRXTBSA-N |
| XLogP | 2.01 |
| TPSA | 194.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.77 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|