C42H50O14S — CID 101426083
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(2S,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methylsulfanyl]oxan-2-yl]methyl acetate (PubChem CID 101426083) has the molecular formula C42H50O14S and a molecular weight of 810.92 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(2S,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methylsulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(2S,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methylsulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101426083 |
| Molecular Formula | C42H50O14S |
| Molecular Weight | 810.92 g/mol |
| Exact Mass | 810.29 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(2S,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methylsulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CO[C@H]1O[C@H](CS[C@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C42H50O14S/c1-26(43)48-24-33-36(52-27(2)44)38(53-28(3)45)40(54-29(4)46)42(56-33)57-25-34-35(49-21-30-15-9-6-10-16-30)37(50-22-31-17-11-7-12-18-31)39(41(47-5)55-34)51-23-32-19-13-8-14-20-32/h6-20,33-42H,21-25H2,1-5H3/t33-,34-,35-,36-,37+,38+,39-,40-,41+,42-/m1/s1 |
| InChIKey | YCOZCRVNJATBID-OHABZOMFSA-N |
| XLogP | 4.93 |
| TPSA | 160.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.92 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|