C41H48O14S2 — CID 102583114
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]disulfanyl]oxan-2-yl]methyl acetate (PubChem CID 102583114) has the molecular formula C41H48O14S2 and a molecular weight of 828.96 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]disulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]disulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102583114 |
| Molecular Formula | C41H48O14S2 |
| Molecular Weight | 828.96 g/mol |
| Exact Mass | 828.25 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]disulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SS[C@H]2O[C@H](CO)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C41H48O14S2/c1-25(43)47-24-33-35(51-26(2)44)37(52-27(3)45)39(53-28(4)46)41(55-33)57-56-40-38(50-23-31-18-12-7-13-19-31)36(49-22-30-16-10-6-11-17-30)34(32(20-42)54-40)48-21-29-14-8-5-9-15-29/h5-19,32-42H,20-24H2,1-4H3/t32-,33-,34-,35-,36+,37+,38-,39-,40-,41+/m1/s1 |
| InChIKey | WAHLNHHIMRQXJH-OUZRASGDSA-N |
| XLogP | 4.92 |
| TPSA | 171.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.96 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|