C26H30O8S — CID 78160303
[3,5-diacetyloxy-6-(4-methylphenyl)sulfanyl-4-phenylmethoxyoxan-2-yl]methyl acetate (PubChem CID 78160303) has the molecular formula C26H30O8S and a molecular weight of 502.59 g/mol. Its IUPAC name is [3,5-diacetyloxy-6-(4-methylphenyl)sulfanyl-4-phenylmethoxyoxan-2-yl]methyl acetate.
| Compound Name | [3,5-diacetyloxy-6-(4-methylphenyl)sulfanyl-4-phenylmethoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 78160303 |
| Molecular Formula | C26H30O8S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | [3,5-diacetyloxy-6-(4-methylphenyl)sulfanyl-4-phenylmethoxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Sc2ccc(C)cc2)C(OC(C)=O)C(OCc2ccccc2)C1OC(C)=O |
| InChI | InChI=1S/C26H30O8S/c1-16-10-12-21(13-11-16)35-26-25(33-19(4)29)24(31-14-20-8-6-5-7-9-20)23(32-18(3)28)22(34-26)15-30-17(2)27/h5-13,22-26H,14-15H2,1-4H3 |
| InChIKey | YBROBAJTJZCPEO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|