C18H22O7S — CID 135073211
[(2R,5S)-3,4-diacetyloxy-5-(4-methylphenyl)sulfanyloxolan-2-yl]methyl acetate (PubChem CID 135073211) has the molecular formula C18H22O7S and a molecular weight of 382.43 g/mol. Its IUPAC name is [(2R,5S)-3,4-diacetyloxy-5-(4-methylphenyl)sulfanyloxolan-2-yl]methyl acetate.
| Compound Name | [(2R,5S)-3,4-diacetyloxy-5-(4-methylphenyl)sulfanyloxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135073211 |
| Molecular Formula | C18H22O7S |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | [(2R,5S)-3,4-diacetyloxy-5-(4-methylphenyl)sulfanyloxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Sc2ccc(C)cc2)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C18H22O7S/c1-10-5-7-14(8-6-10)26-18-17(24-13(4)21)16(23-12(3)20)15(25-18)9-22-11(2)19/h5-8,15-18H,9H2,1-4H3/t15-,16?,17?,18+/m1/s1 |
| InChIKey | ZGLXRGOLHXAWPQ-CPFNUKBASA-N |
| XLogP | 2.24 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|