C17H20O7S — CID 102482414
[(2R,3R,4S,5S)-3,4-diacetyloxy-5-phenylsulfanyloxolan-2-yl]methyl acetate (PubChem CID 102482414) has the molecular formula C17H20O7S and a molecular weight of 368.41 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-3,4-diacetyloxy-5-phenylsulfanyloxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S)-3,4-diacetyloxy-5-phenylsulfanyloxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102482414 |
| Molecular Formula | C17H20O7S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | [(2R,3R,4S,5S)-3,4-diacetyloxy-5-phenylsulfanyloxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Sc2ccccc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H20O7S/c1-10(18)21-9-14-15(22-11(2)19)16(23-12(3)20)17(24-14)25-13-7-5-4-6-8-13/h4-8,14-17H,9H2,1-3H3/t14-,15-,16+,17+/m1/s1 |
| InChIKey | CSENHCTYHNGBNU-NCOADZHNSA-N |
| XLogP | 1.93 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|