C19H24O8S — CID 163587991
[(3R,6S)-4,5-diacetyloxy-3-hydroxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl acetate (PubChem CID 163587991) has the molecular formula C19H24O8S and a molecular weight of 412.46 g/mol. Its IUPAC name is [(3R,6S)-4,5-diacetyloxy-3-hydroxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,6S)-4,5-diacetyloxy-3-hydroxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163587991 |
| Molecular Formula | C19H24O8S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | [(3R,6S)-4,5-diacetyloxy-3-hydroxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](Sc2ccc(C)cc2)C(OC(C)=O)C(OC(C)=O)[C@@H]1O |
| InChI | InChI=1S/C19H24O8S/c1-10-5-7-14(8-6-10)28-19-18(26-13(4)22)17(25-12(3)21)16(23)15(27-19)9-24-11(2)20/h5-8,15-19,23H,9H2,1-4H3/t15?,16-,17?,18?,19+/m1/s1 |
| InChIKey | GNCRECKLQBDKKJ-WVFDYHARSA-N |
| XLogP | 1.60 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|