C17H23NO6S — CID 102266235
[(2R,3S,4R,5R,6S)-5-acetamido-3,4-dihydroxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl acetate (PubChem CID 102266235) has the molecular formula C17H23NO6S and a molecular weight of 369.44 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-acetamido-3,4-dihydroxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-acetamido-3,4-dihydroxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102266235 |
| Molecular Formula | C17H23NO6S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-acetamido-3,4-dihydroxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](COC(C)=O)O[C@H]1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C17H23NO6S/c1-9-4-6-12(7-5-9)25-17-14(18-10(2)19)16(22)15(21)13(24-17)8-23-11(3)20/h4-7,13-17,21-22H,8H2,1-3H3,(H,18,19)/t13-,14-,15-,16-,17+/m1/s1 |
| InChIKey | XQTFUZUUCRUFCC-HHARLNAUSA-N |
| XLogP | 0.60 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |