C15H19N3O5S — CID 51031882
[(2R,3S,4R,5R,6R)-5-azido-3,4-dihydroxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl acetate (PubChem CID 51031882) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-azido-3,4-dihydroxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-azido-3,4-dihydroxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 51031882 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-azido-3,4-dihydroxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Sc2ccc(C)cc2)[C@H](N=[N+]=[N-])[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H19N3O5S/c1-8-3-5-10(6-4-8)24-15-12(17-18-16)14(21)13(20)11(23-15)7-22-9(2)19/h3-6,11-15,20-21H,7H2,1-2H3/t11-,12-,13-,14-,15-/m1/s1 |
| InChIKey | DMFIKMAVPLVRIA-KJWHEZOQSA-N |
| XLogP | 1.78 |
| TPSA | 124.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|