C21H21N3O6S — CID 12010376
[(2R,3S,4S,5R,6S)-5-acetyloxy-4-azido-3-hydroxy-6-phenylsulfanyloxan-2-yl]methyl benzoate (PubChem CID 12010376) has the molecular formula C21H21N3O6S and a molecular weight of 443.48 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-5-acetyloxy-4-azido-3-hydroxy-6-phenylsulfanyloxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R,6S)-5-acetyloxy-4-azido-3-hydroxy-6-phenylsulfanyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 12010376 |
| Molecular Formula | C21H21N3O6S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-5-acetyloxy-4-azido-3-hydroxy-6-phenylsulfanyloxan-2-yl]methyl benzoate |
| SMILES | CC(=O)O[C@@H]1[C@@H](N=[N+]=[N-])[C@H](O)[C@@H](COC(=O)c2ccccc2)O[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C21H21N3O6S/c1-13(25)29-19-17(23-24-22)18(26)16(12-28-20(27)14-8-4-2-5-9-14)30-21(19)31-15-10-6-3-7-11-15/h2-11,16-19,21,26H,12H2,1H3/t16-,17+,18-,19-,21+/m1/s1 |
| InChIKey | OURYPQIPSVFGCM-HZVKZAKPSA-N |
| XLogP | 3.33 |
| TPSA | 130.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|