C14H14ClN3O5 — CID 54476303
[(2R,3S,4S)-3-acetyloxy-4-azido-5-chlorooxolan-2-yl]methyl benzoate (PubChem CID 54476303) has the molecular formula C14H14ClN3O5 and a molecular weight of 339.74 g/mol. Its IUPAC name is [(2R,3S,4S)-3-acetyloxy-4-azido-5-chlorooxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S)-3-acetyloxy-4-azido-5-chlorooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 54476303 |
| Molecular Formula | C14H14ClN3O5 |
| Molecular Weight | 339.74 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | [(2R,3S,4S)-3-acetyloxy-4-azido-5-chlorooxolan-2-yl]methyl benzoate |
| SMILES | CC(=O)O[C@H]1[C@H](N=[N+]=[N-])C(Cl)O[C@@H]1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H14ClN3O5/c1-8(19)22-12-10(23-13(15)11(12)17-18-16)7-21-14(20)9-5-3-2-4-6-9/h2-6,10-13H,7H2,1H3/t10-,11+,12-,13?/m1/s1 |
| InChIKey | XLUYDIYVOAGZEH-DAAZQVBGSA-N |
| XLogP | 2.42 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.74 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|