C19H16FN3O5 — CID 18666645
[(2R,3R,4S)-5-azido-3-benzoyloxy-4-fluorooxolan-2-yl]methyl benzoate (PubChem CID 18666645) has the molecular formula C19H16FN3O5 and a molecular weight of 385.35 g/mol. Its IUPAC name is [(2R,3R,4S)-5-azido-3-benzoyloxy-4-fluorooxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S)-5-azido-3-benzoyloxy-4-fluorooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 18666645 |
| Molecular Formula | C19H16FN3O5 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | [(2R,3R,4S)-5-azido-3-benzoyloxy-4-fluorooxolan-2-yl]methyl benzoate |
| SMILES | [N-]=[N+]=NC1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1F |
| InChI | InChI=1S/C19H16FN3O5/c20-15-16(28-19(25)13-9-5-2-6-10-13)14(27-17(15)22-23-21)11-26-18(24)12-7-3-1-4-8-12/h1-10,14-17H,11H2/t14-,15+,16-,17?/m1/s1 |
| InChIKey | GNDBWIFFBHMUPT-LVYZTWJOSA-N |
| XLogP | 3.44 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|