C28H23NO7 — CID 59649569
[3,4-dibenzoyloxy-5-(ethenylideneamino)oxolan-2-yl]methyl benzoate (PubChem CID 59649569) has the molecular formula C28H23NO7 and a molecular weight of 485.49 g/mol. Its IUPAC name is [3,4-dibenzoyloxy-5-(ethenylideneamino)oxolan-2-yl]methyl benzoate.
| Compound Name | [3,4-dibenzoyloxy-5-(ethenylideneamino)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 59649569 |
| Molecular Formula | C28H23NO7 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | [3,4-dibenzoyloxy-5-(ethenylideneamino)oxolan-2-yl]methyl benzoate |
| SMILES | C=C=NC1OC(COC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H23NO7/c1-2-29-25-24(36-28(32)21-16-10-5-11-17-21)23(35-27(31)20-14-8-4-9-15-20)22(34-25)18-33-26(30)19-12-6-3-7-13-19/h3-17,22-25H,1,18H2 |
| InChIKey | QNOCJZAFAUABGE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|