C26H21FO7 — CID 59915156
[(4S)-3,5-dibenzoyloxy-4-fluorooxolan-2-yl]methyl benzoate (PubChem CID 59915156) has the molecular formula C26H21FO7 and a molecular weight of 464.45 g/mol. Its IUPAC name is [(4S)-3,5-dibenzoyloxy-4-fluorooxolan-2-yl]methyl benzoate.
| Compound Name | [(4S)-3,5-dibenzoyloxy-4-fluorooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 59915156 |
| Molecular Formula | C26H21FO7 |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | [(4S)-3,5-dibenzoyloxy-4-fluorooxolan-2-yl]methyl benzoate |
| SMILES | O=C(OCC1OC(OC(=O)c2ccccc2)[C@@H](F)C1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H21FO7/c27-21-22(33-24(29)18-12-6-2-7-13-18)20(16-31-23(28)17-10-4-1-5-11-17)32-26(21)34-25(30)19-14-8-3-9-15-19/h1-15,20-22,26H,16H2/t20?,21-,22?,26?/m0/s1 |
| InChIKey | JOAHVPNLVYCSAN-XOSCFKQTSA-N |
| XLogP | 3.99 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|