C29H28O7 — CID 160727114
(3,6-dibenzoyloxy-4,5-dimethyloxan-2-yl)methyl benzoate (PubChem CID 160727114) has the molecular formula C29H28O7 and a molecular weight of 488.54 g/mol. Its IUPAC name is (3,6-dibenzoyloxy-4,5-dimethyloxan-2-yl)methyl benzoate.
| Compound Name | (3,6-dibenzoyloxy-4,5-dimethyloxan-2-yl)methyl benzoate |
|---|---|
| PubChem CID | 160727114 |
| Molecular Formula | C29H28O7 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | (3,6-dibenzoyloxy-4,5-dimethyloxan-2-yl)methyl benzoate |
| SMILES | CC1C(OC(=O)c2ccccc2)OC(COC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1C |
| InChI | InChI=1S/C29H28O7/c1-19-20(2)29(36-28(32)23-16-10-5-11-17-23)34-24(18-33-26(30)21-12-6-3-7-13-21)25(19)35-27(31)22-14-8-4-9-15-22/h3-17,19-20,24-25,29H,18H2,1-2H3 |
| InChIKey | ICSZBGQSWFZYBL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|