C12H16ClN3O7 — CID 129141116
[(3R,6S)-3,4-diacetyloxy-5-azido-6-chlorooxan-2-yl]methyl acetate (PubChem CID 129141116) has the molecular formula C12H16ClN3O7 and a molecular weight of 349.73 g/mol. Its IUPAC name is [(3R,6S)-3,4-diacetyloxy-5-azido-6-chlorooxan-2-yl]methyl acetate.
| Compound Name | [(3R,6S)-3,4-diacetyloxy-5-azido-6-chlorooxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 129141116 |
| Molecular Formula | C12H16ClN3O7 |
| Molecular Weight | 349.73 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | [(3R,6S)-3,4-diacetyloxy-5-azido-6-chlorooxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](Cl)C(N=[N+]=[N-])C(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C12H16ClN3O7/c1-5(17)20-4-8-10(21-6(2)18)11(22-7(3)19)9(15-16-14)12(13)23-8/h8-12H,4H2,1-3H3/t8?,9?,10-,11?,12+/m0/s1 |
| InChIKey | DOGAQWBZVNXURX-TXIHYXHLSA-N |
| XLogP | 1.06 |
| TPSA | 136.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.73 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|