C12H17N3O8 — CID 124747063
[(2S,3S,4S,5R,6S)-3,4-diacetyloxy-5-azido-6-hydroxyoxan-2-yl]methyl acetate (PubChem CID 124747063) has the molecular formula C12H17N3O8 and a molecular weight of 331.28 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-3,4-diacetyloxy-5-azido-6-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5R,6S)-3,4-diacetyloxy-5-azido-6-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 124747063 |
| Molecular Formula | C12H17N3O8 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-3,4-diacetyloxy-5-azido-6-hydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](O)[C@H](N=[N+]=[N-])[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C12H17N3O8/c1-5(16)20-4-8-10(21-6(2)17)11(22-7(3)18)9(14-15-13)12(19)23-8/h8-12,19H,4H2,1-3H3/t8-,9+,10+,11-,12-/m0/s1 |
| InChIKey | PLVPDCSPQJIUQM-KNZXXDILSA-N |
| XLogP | -0.19 |
| TPSA | 157.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|