C16H29N3O7Si — CID 11675770
[(2R,3S,4R,5S,6S)-4-acetyloxy-5-azido-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxyoxan-3-yl] acetate (PubChem CID 11675770) has the molecular formula C16H29N3O7Si and a molecular weight of 403.51 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-4-acetyloxy-5-azido-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxyoxan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5S,6S)-4-acetyloxy-5-azido-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 11675770 |
| Molecular Formula | C16H29N3O7Si |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-4-acetyloxy-5-azido-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](N=[N+]=[N-])[C@@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H29N3O7Si/c1-9(20)24-13-11(8-23-27(6,7)16(3,4)5)26-15(22)12(18-19-17)14(13)25-10(2)21/h11-15,22H,8H2,1-7H3/t11-,12+,13-,14-,15+/m1/s1 |
| InChIKey | DHRXMYQVMRQTRU-KHMAMNHCSA-N |
| XLogP | 2.27 |
| TPSA | 140.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|