C14H16Cl3N3O9 — CID 102460148
[(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-azidooxan-2-yl] 2,2,2-trichloroacetate (PubChem CID 102460148) has the molecular formula C14H16Cl3N3O9 and a molecular weight of 476.65 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-azidooxan-2-yl] 2,2,2-trichloroacetate.
| Compound Name | [(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-azidooxan-2-yl] 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 102460148 |
| Molecular Formula | C14H16Cl3N3O9 |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 475.00 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-azidooxan-2-yl] 2,2,2-trichloroacetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(=O)C(Cl)(Cl)Cl)[C@H](N=[N+]=[N-])[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H16Cl3N3O9/c1-5(21)25-4-8-10(26-6(2)22)11(27-7(3)23)9(19-20-18)12(28-8)29-13(24)14(15,16)17/h8-12H,4H2,1-3H3/t8-,9-,10-,11-,12+/m1/s1 |
| InChIKey | GVAOESZFJDRIKH-OOCWMUITSA-N |
| XLogP | 1.73 |
| TPSA | 163.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|