C20H35N3O8Si — CID 76764654
[(2R,3R,4R,5R,6S)-3,4-diacetyloxy-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxyoxan-2-yl]methyl acetate (PubChem CID 76764654) has the molecular formula C20H35N3O8Si and a molecular weight of 473.60 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-3,4-diacetyloxy-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6S)-3,4-diacetyloxy-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 76764654 |
| Molecular Formula | C20H35N3O8Si |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-3,4-diacetyloxy-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[Si](C)(C)C(C)(C)C(C)C)[C@H](N=[N+]=[N-])[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H35N3O8Si/c1-11(2)20(6,7)32(8,9)31-19-16(22-23-21)18(29-14(5)26)17(28-13(4)25)15(30-19)10-27-12(3)24/h11,15-19H,10H2,1-9H3/t15-,16-,17+,18-,19+/m1/s1 |
| InChIKey | QUZVZKLPCZXXGM-FQBWVUSXSA-N |
| XLogP | 3.47 |
| TPSA | 146.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|