C28H49N3O10Si — CID 158216829
[(3S,4R,6S)-3-[(2S,4S,5S)-3-acetyloxy-4,5,6-trimethyloxan-2-yl]oxy-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-4-methyloxan-2-yl]methyl acetate;carbon dioxide (PubChem CID 158216829) has the molecular formula C28H49N3O10Si and a molecular weight of 615.80 g/mol. Its IUPAC name is [(3S,4R,6S)-3-[(2S,4S,5S)-3-acetyloxy-4,5,6-trimethyloxan-2-yl]oxy-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-4-methyloxan-2-yl]methyl acetate;carbon dioxide.
| Compound Name | [(3S,4R,6S)-3-[(2S,4S,5S)-3-acetyloxy-4,5,6-trimethyloxan-2-yl]oxy-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-4-methyloxan-2-yl]methyl acetate;carbon dioxide |
|---|---|
| PubChem CID | 158216829 |
| Molecular Formula | C28H49N3O10Si |
| Molecular Weight | 615.80 g/mol |
| Exact Mass | 615.32 |
| IUPAC Name | [(3S,4R,6S)-3-[(2S,4S,5S)-3-acetyloxy-4,5,6-trimethyloxan-2-yl]oxy-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-4-methyloxan-2-yl]methyl acetate;carbon dioxide |
| SMILES | CC(=O)OCC1O[C@@H](O[Si](C)(C)C(C)(C)C(C)C)C(N=[N+]=[N-])[C@@H](C)[C@@H]1O[C@@H]1OC(C)[C@@H](C)[C@H](C)C1OC(C)=O.O=C=O |
| InChI | InChI=1S/C27H49N3O8Si.CO2/c1-14(2)27(9,10)39(11,12)38-25-22(29-30-28)17(5)23(21(36-25)13-33-19(7)31)37-26-24(35-20(8)32)16(4)15(3)18(6)34-26;2-1-3/h14-18,21-26H,13H2,1-12H3;/t15-,16-,17+,18?,21?,22?,23-,24?,25-,26-;/m0./s1 |
| InChIKey | GCTHSHRMKMNLMK-QEVVLAKVSA-N |
| XLogP | 5.00 |
| TPSA | 172.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.80 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|