C24H47N3O5Si — CID 158492021
(3S,4R,6S)-6-[(3S,4R,6S)-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2-ethyl-4-methyloxan-3-yl]oxy-2,4,5-trimethyloxan-3-ol (PubChem CID 158492021) has the molecular formula C24H47N3O5Si and a molecular weight of 485.74 g/mol. Its IUPAC name is (3S,4R,6S)-6-[(3S,4R,6S)-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2-ethyl-4-methyloxan-3-yl]oxy-2,4,5-trimethyloxan-3-ol.
| Compound Name | (3S,4R,6S)-6-[(3S,4R,6S)-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2-ethyl-4-methyloxan-3-yl]oxy-2,4,5-trimethyloxan-3-ol |
|---|---|
| PubChem CID | 158492021 |
| Molecular Formula | C24H47N3O5Si |
| Molecular Weight | 485.74 g/mol |
| Exact Mass | 485.33 |
| IUPAC Name | (3S,4R,6S)-6-[(3S,4R,6S)-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2-ethyl-4-methyloxan-3-yl]oxy-2,4,5-trimethyloxan-3-ol |
| SMILES | CCC1O[C@@H](O[Si](C)(C)C(C)(C)C(C)C)C(N=[N+]=[N-])[C@@H](C)[C@@H]1O[C@@H]1OC(C)[C@@H](O)[C@H](C)C1C |
| InChI | InChI=1S/C24H47N3O5Si/c1-12-18-21(31-22-15(5)14(4)20(28)17(7)29-22)16(6)19(26-27-25)23(30-18)32-33(10,11)24(8,9)13(2)3/h13-23,28H,12H2,1-11H3/t14-,15?,16-,17?,18?,19?,20+,21+,22+,23+/m1/s1 |
| InChIKey | DBRCJOCSNMKCDQ-ODCCXUTKSA-N |
| XLogP | 5.86 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.74 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|