C18H34O4 — CID 91414509
(3S,4S,6S)-6-[(3S,6R)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-2,4,5-trimethyloxan-3-ol (PubChem CID 91414509) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is (3S,4S,6S)-6-[(3S,6R)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-2,4,5-trimethyloxan-3-ol.
| Compound Name | (3S,4S,6S)-6-[(3S,6R)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-2,4,5-trimethyloxan-3-ol |
|---|---|
| PubChem CID | 91414509 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | (3S,4S,6S)-6-[(3S,6R)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-2,4,5-trimethyloxan-3-ol |
| SMILES | CCC1O[C@H](C)C(C)C(C)[C@@H]1O[C@@H]1OC(C)[C@@H](O)[C@@H](C)C1C |
| InChI | InChI=1S/C18H34O4/c1-8-15-17(11(4)9(2)13(6)20-15)22-18-12(5)10(3)16(19)14(7)21-18/h9-19H,8H2,1-7H3/t9?,10-,11?,12?,13+,14?,15?,16-,17-,18-/m0/s1 |
| InChIKey | SLIQSBJORBZQMG-JAECXENLSA-N |
| XLogP | 3.22 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |