C17H32Ac3O6 — CID 59042947
actinium;(2S,5S,6S)-2-[(3R,4R,6S)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-6-(hydroxymethyl)-4-methyloxane-3,5-diol (PubChem CID 59042947) has the molecular formula C17H32Ac3O6 and a molecular weight of 1013.44 g/mol. Its IUPAC name is actinium;(2S,5S,6S)-2-[(3R,4R,6S)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-6-(hydroxymethyl)-4-methyloxane-3,5-diol.
| Compound Name | actinium;(2S,5S,6S)-2-[(3R,4R,6S)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-6-(hydroxymethyl)-4-methyloxane-3,5-diol |
|---|---|
| PubChem CID | 59042947 |
| Molecular Formula | C17H32Ac3O6 |
| Molecular Weight | 1013.44 g/mol |
| Exact Mass | 1013.30 |
| IUPAC Name | actinium;(2S,5S,6S)-2-[(3R,4R,6S)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-6-(hydroxymethyl)-4-methyloxane-3,5-diol |
| SMILES | CCC1O[C@@H](C)C(C)[C@@H](C)[C@H]1O[C@H]1O[C@@H](CO)[C@@H](O)C(C)C1O.[Ac].[Ac].[Ac] |
| InChI | InChI=1S/C17H32O6.3Ac/c1-6-12-16(9(3)8(2)11(5)21-12)23-17-15(20)10(4)14(19)13(7-18)22-17;;;/h8-20H,6-7H2,1-5H3;;;/t8?,9-,10?,11+,12?,13+,14+,15?,16-,17-;;;/m1.../s1 |
| InChIKey | XVAQFMHDDJDYQA-WGSGYCFZSA-N |
| XLogP | 0.92 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.44 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |