C17H32O6 — CID 59101140
(3S,4R)-4-[(2S,4S,5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-2-(hydroxymethyl)-6-methyloxane-3,5-diol (PubChem CID 59101140) has the molecular formula C17H32O6 and a molecular weight of 332.44 g/mol. Its IUPAC name is (3S,4R)-4-[(2S,4S,5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-2-(hydroxymethyl)-6-methyloxane-3,5-diol.
| Compound Name | (3S,4R)-4-[(2S,4S,5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-2-(hydroxymethyl)-6-methyloxane-3,5-diol |
|---|---|
| PubChem CID | 59101140 |
| Molecular Formula | C17H32O6 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | (3S,4R)-4-[(2S,4S,5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-2-(hydroxymethyl)-6-methyloxane-3,5-diol |
| SMILES | CCC1O[C@@H](O[C@@H]2C(O)C(C)OC(CO)[C@@H]2O)C(C)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C17H32O6/c1-6-12-9(3)8(2)10(4)17(22-12)23-16-14(19)11(5)21-13(7-18)15(16)20/h8-20H,6-7H2,1-5H3/t8-,9+,10?,11?,12?,13?,14?,15-,16+,17-/m0/s1 |
| InChIKey | LTUIZCFUUIVUSH-NYHMXWFYSA-N |
| XLogP | 0.92 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |