C29H54O5 — CID 90909875
(2S,3S,6S)-2-ethyl-3-[(2R,5S,6S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-6-[(3S,4R,6R)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-4,5-dimethyloxane (PubChem CID 90909875) has the molecular formula C29H54O5 and a molecular weight of 482.75 g/mol. Its IUPAC name is (2S,3S,6S)-2-ethyl-3-[(2R,5S,6S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-6-[(3S,4R,6R)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-4,5-dimethyloxane.
| Compound Name | (2S,3S,6S)-2-ethyl-3-[(2R,5S,6S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-6-[(3S,4R,6R)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-4,5-dimethyloxane |
|---|---|
| PubChem CID | 90909875 |
| Molecular Formula | C29H54O5 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.40 |
| IUPAC Name | (2S,3S,6S)-2-ethyl-3-[(2R,5S,6S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-6-[(3S,4R,6R)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-4,5-dimethyloxane |
| SMILES | CCC1O[C@H](C)C(C)[C@@H](C)[C@@H]1O[C@@H]1O[C@@H](CC)[C@@H](O[C@H]2O[C@@H](CC)[C@@H](C)C(C)C2C)C(C)C1C |
| InChI | InChI=1S/C29H54O5/c1-12-23-17(6)15(4)20(9)28(31-23)34-27-19(8)21(10)29(32-25(27)14-3)33-26-18(7)16(5)22(11)30-24(26)13-2/h15-29H,12-14H2,1-11H3/t15?,16?,17-,18+,19?,20?,21?,22+,23-,24?,25-,26-,27-,28+,29-/m0/s1 |
| InChIKey | IAQIESUZEKJBLL-JPODXSJTSA-N |
| XLogP | 6.68 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |