C29H52O6 — CID 162174979
1-[(3R,5S,6R)-3-[(2S,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-6-[(3S,4R)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-4,5-dimethyloxan-2-yl]ethanone (PubChem CID 162174979) has the molecular formula C29H52O6 and a molecular weight of 496.73 g/mol. Its IUPAC name is 1-[(3R,5S,6R)-3-[(2S,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-6-[(3S,4R)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-4,5-dimethyloxan-2-yl]ethanone.
| Compound Name | 1-[(3R,5S,6R)-3-[(2S,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-6-[(3S,4R)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-4,5-dimethyloxan-2-yl]ethanone |
|---|---|
| PubChem CID | 162174979 |
| Molecular Formula | C29H52O6 |
| Molecular Weight | 496.73 g/mol |
| Exact Mass | 496.38 |
| IUPAC Name | 1-[(3R,5S,6R)-3-[(2S,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-6-[(3S,4R)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-4,5-dimethyloxan-2-yl]ethanone |
| SMILES | CCC1O[C@@H](O[C@H]2C(C(C)=O)O[C@@H](O[C@@H]3C(CC)OC(C)C(C)[C@H]3C)[C@@H](C)C2C)C(C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C29H52O6/c1-12-23-16(5)14(3)19(8)28(32-23)34-26-18(7)20(9)29(35-27(26)21(10)30)33-25-17(6)15(4)22(11)31-24(25)13-2/h14-20,22-29H,12-13H2,1-11H3/t14-,15?,16-,17+,18?,19?,20-,22?,23?,24?,25-,26+,27?,28-,29+/m0/s1 |
| InChIKey | ZOGUVSOLNVCNDL-GWVATXIBSA-N |
| XLogP | 5.86 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.73 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |