C29H54O6 — CID 71047600
(3S,4R,6S)-2-ethyl-3-[(2R,4R,5S)-6-[[(4S,5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxymethyl]-5-methoxy-3,4-dimethyloxan-2-yl]oxy-4,5,6-trimethyloxane (PubChem CID 71047600) has the molecular formula C29H54O6 and a molecular weight of 498.75 g/mol. Its IUPAC name is (3S,4R,6S)-2-ethyl-3-[(2R,4R,5S)-6-[[(4S,5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxymethyl]-5-methoxy-3,4-dimethyloxan-2-yl]oxy-4,5,6-trimethyloxane.
| Compound Name | (3S,4R,6S)-2-ethyl-3-[(2R,4R,5S)-6-[[(4S,5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxymethyl]-5-methoxy-3,4-dimethyloxan-2-yl]oxy-4,5,6-trimethyloxane |
|---|---|
| PubChem CID | 71047600 |
| Molecular Formula | C29H54O6 |
| Molecular Weight | 498.75 g/mol |
| Exact Mass | 498.39 |
| IUPAC Name | (3S,4R,6S)-2-ethyl-3-[(2R,4R,5S)-6-[[(4S,5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxymethyl]-5-methoxy-3,4-dimethyloxan-2-yl]oxy-4,5,6-trimethyloxane |
| SMILES | CCC1O[C@@H](C)C(C)[C@@H](C)[C@@H]1O[C@@H]1OC(COC2OC(CC)[C@H](C)[C@H](C)C2C)[C@@H](OC)[C@H](C)C1C |
| InChI | InChI=1S/C29H54O6/c1-12-23-17(5)15(3)20(8)28(33-23)31-14-25-26(30-11)19(7)21(9)29(34-25)35-27-18(6)16(4)22(10)32-24(27)13-2/h15-29H,12-14H2,1-11H3/t15-,16?,17+,18+,19+,20?,21?,22-,23?,24?,25?,26-,27-,28?,29-/m0/s1 |
| InChIKey | XUXYZUFYBHWDDC-XDILNLPLSA-N |
| XLogP | 5.91 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.75 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |