C28H52O6 — CID 59044769
(2R,3S,6R)-2-ethyl-6-[(2R,3S,6R)-2-ethyl-6-[(3R,4R,6S)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-4,5-dimethyloxan-3-yl]oxy-4,5-dimethyloxan-3-ol (PubChem CID 59044769) has the molecular formula C28H52O6 and a molecular weight of 484.72 g/mol. Its IUPAC name is (2R,3S,6R)-2-ethyl-6-[(2R,3S,6R)-2-ethyl-6-[(3R,4R,6S)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-4,5-dimethyloxan-3-yl]oxy-4,5-dimethyloxan-3-ol.
| Compound Name | (2R,3S,6R)-2-ethyl-6-[(2R,3S,6R)-2-ethyl-6-[(3R,4R,6S)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-4,5-dimethyloxan-3-yl]oxy-4,5-dimethyloxan-3-ol |
|---|---|
| PubChem CID | 59044769 |
| Molecular Formula | C28H52O6 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.38 |
| IUPAC Name | (2R,3S,6R)-2-ethyl-6-[(2R,3S,6R)-2-ethyl-6-[(3R,4R,6S)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-4,5-dimethyloxan-3-yl]oxy-4,5-dimethyloxan-3-ol |
| SMILES | CCC1O[C@@H](C)C(C)[C@@H](C)[C@H]1O[C@H]1O[C@H](CC)[C@@H](O[C@H]2O[C@H](CC)[C@@H](O)C(C)C2C)C(C)C1C |
| InChI | InChI=1S/C28H52O6/c1-11-21-24(29)15(5)18(8)27(31-21)34-26-17(7)19(9)28(32-23(26)13-3)33-25-16(6)14(4)20(10)30-22(25)12-2/h14-29H,11-13H2,1-10H3/t14?,15?,16-,17?,18?,19?,20+,21-,22?,23-,24+,25-,26+,27-,28-/m1/s1 |
| InChIKey | TYKHKTHEAFGEOY-PGPCGKRTSA-N |
| XLogP | 5.40 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |